C35H35NO6S — CID 6690564
4-[[(2R,4R,5S,6S)-2-[4-[2-(acetamidomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6690564) has the molecular formula C35H35NO6S and a molecular weight of 597.73 g/mol. Its IUPAC name is 4-[[(2R,4R,5S,6S)-2-[4-[2-(acetamidomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,5S,6S)-2-[4-[2-(acetamidomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6690564 |
| Molecular Formula | C35H35NO6S |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 4-[[(2R,4R,5S,6S)-2-[4-[2-(acetamidomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | CC(=O)NCc1ccccc1-c1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CSc3ccc(C(=O)O)cc3)O2)cc1 |
| InChI | InChI=1S/C35H35NO6S/c1-22-32(21-43-30-17-15-27(16-18-30)34(39)40)41-35(42-33(22)26-9-7-24(20-37)8-10-26)28-13-11-25(12-14-28)31-6-4-3-5-29(31)19-36-23(2)38/h3-18,22,32-33,35,37H,19-21H2,1-2H3,(H,36,38)(H,39,40)/t22-,32+,33?,35+/m1/s1 |
| InChIKey | XMTLWKOYUTXHEB-UHAZZZFMSA-N |
| XLogP | 6.76 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |