C39H36N2O6S — CID 6684816
4-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[(pyridine-3-carbonylamino)methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6684816) has the molecular formula C39H36N2O6S and a molecular weight of 660.79 g/mol. Its IUPAC name is 4-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[(pyridine-3-carbonylamino)methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[(pyridine-3-carbonylamino)methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6684816 |
| Molecular Formula | C39H36N2O6S |
| Molecular Weight | 660.79 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | 4-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[(pyridine-3-carbonylamino)methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3ccccc3CNC(=O)c3cccnc3)cc2)O[C@@H]1CSc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C39H36N2O6S/c1-25-35(24-48-33-18-16-29(17-19-33)38(44)45)46-39(47-36(25)28-10-8-26(23-42)9-11-28)30-14-12-27(13-15-30)34-7-3-2-5-31(34)22-41-37(43)32-6-4-20-40-21-32/h2-21,25,35-36,39,42H,22-24H2,1H3,(H,41,43)(H,44,45)/t25-,35+,36?,39+/m0/s1 |
| InChIKey | PZMSYSBHPOFWPY-FLLDHSFPSA-N |
| XLogP | 7.45 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.79 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |