C35H32Cl3NO6S — CID 6690555
4-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6690555) has the molecular formula C35H32Cl3NO6S and a molecular weight of 701.07 g/mol. Its IUPAC name is 4-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6690555 |
| Molecular Formula | C35H32Cl3NO6S |
| Molecular Weight | 701.07 g/mol |
| Exact Mass | 699.10 |
| IUPAC Name | 4-[[(2R,4R,5S,6S)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)C(Cl)(Cl)Cl)cc2)O[C@H]1CSc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C35H32Cl3NO6S/c1-21-30(20-46-28-16-14-25(15-17-28)32(41)42)44-33(45-31(21)24-8-6-22(19-40)7-9-24)26-12-10-23(11-13-26)29-5-3-2-4-27(29)18-39-34(43)35(36,37)38/h2-17,21,30-31,33,40H,18-20H2,1H3,(H,39,43)(H,41,42)/t21-,30+,31?,33+/m1/s1 |
| InChIKey | PZASYWFTFBRZEY-CCCQMLQXSA-N |
| XLogP | 8.11 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.07 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|