C34H29NO7S — CID 6690498
4-[[(2R,4R,5S,6S)-2-[3-(1,3-dioxoisoindol-2-yl)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6690498) has the molecular formula C34H29NO7S and a molecular weight of 595.67 g/mol. Its IUPAC name is 4-[[(2R,4R,5S,6S)-2-[3-(1,3-dioxoisoindol-2-yl)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,5S,6S)-2-[3-(1,3-dioxoisoindol-2-yl)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6690498 |
| Molecular Formula | C34H29NO7S |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | 4-[[(2R,4R,5S,6S)-2-[3-(1,3-dioxoisoindol-2-yl)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | C[C@@H]1[C@H](CSc2ccc(C(=O)O)cc2)O[C@H](c2cccc(N3C(=O)c4ccccc4C3=O)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C34H29NO7S/c1-20-29(19-43-26-15-13-23(14-16-26)33(39)40)41-34(42-30(20)22-11-9-21(18-36)10-12-22)24-5-4-6-25(17-24)35-31(37)27-7-2-3-8-28(27)32(35)38/h2-17,20,29-30,34,36H,18-19H2,1H3,(H,39,40)/t20-,29+,30+,34+/m1/s1 |
| InChIKey | FUHLUYTZUXCRCJ-FLCULLBDSA-N |
| XLogP | 6.26 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|