C42H34N2O6S — CID 6687166
2-[3-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6687166) has the molecular formula C42H34N2O6S and a molecular weight of 694.81 g/mol. Its IUPAC name is 2-[3-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6687166 |
| Molecular Formula | C42H34N2O6S |
| Molecular Weight | 694.81 g/mol |
| Exact Mass | 694.21 |
| IUPAC Name | 2-[3-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C[C@H]1[C@@H](CSc2nc(-c3ccccc3)c(-c3ccccc3)o2)O[C@@H](c2cccc(N3C(=O)c4ccccc4C3=O)c2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C42H34N2O6S/c1-26-35(25-51-42-43-36(28-11-4-2-5-12-28)38(50-42)29-13-6-3-7-14-29)48-41(49-37(26)30-21-19-27(24-45)20-22-30)31-15-10-16-32(23-31)44-39(46)33-17-8-9-18-34(33)40(44)47/h2-23,26,35,37,41,45H,24-25H2,1H3/t26-,35+,37+,41+/m0/s1 |
| InChIKey | VBIDEIZTTMOXQK-OKNBDIGVSA-N |
| XLogP | 8.89 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.81 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|