C48H42N2O5S — CID 6692947
N-[[3-[4-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6692947) has the molecular formula C48H42N2O5S and a molecular weight of 758.94 g/mol. Its IUPAC name is N-[[3-[4-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[4-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6692947 |
| Molecular Formula | C48H42N2O5S |
| Molecular Weight | 758.94 g/mol |
| Exact Mass | 758.28 |
| IUPAC Name | N-[[3-[4-[(2R,4R,5S,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(-c3cccc(CNC(=O)c4ccccc4)c3)cc2)O[C@H]1CSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C48H42N2O5S/c1-32-42(31-56-48-50-43(36-13-5-2-6-14-36)45(55-48)37-15-7-3-8-16-37)53-47(54-44(32)38-22-20-33(30-51)21-23-38)40-26-24-35(25-27-40)41-19-11-12-34(28-41)29-49-46(52)39-17-9-4-10-18-39/h2-28,32,42,44,47,51H,29-31H2,1H3,(H,49,52)/t32-,42+,44?,47+/m1/s1 |
| InChIKey | NYQBLNXJSURUCE-TWUGEQONSA-N |
| XLogP | 10.68 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.94 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |