C40H35NO5S — CID 6688176
2-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6688176) has the molecular formula C40H35NO5S and a molecular weight of 641.79 g/mol. Its IUPAC name is 2-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6688176 |
| Molecular Formula | C40H35NO5S |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | 2-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CSc2ccccc2)O[C@H](c2cccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C40H35NO5S/c1-26-36(25-47-33-13-3-2-4-14-33)45-40(46-37(26)29-19-17-27(24-42)18-20-29)32-12-8-11-31(22-32)30-10-7-9-28(21-30)23-41-38(43)34-15-5-6-16-35(34)39(41)44/h2-22,26,36-37,40,42H,23-25H2,1H3/t26-,36+,37+,40+/m1/s1 |
| InChIKey | SLGPWULZICUJNZ-VNAYAWJFSA-N |
| XLogP | 8.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|