C36H33N5O5S — CID 6688934
2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6688934) has the molecular formula C36H33N5O5S and a molecular weight of 647.76 g/mol. Its IUPAC name is 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6688934 |
| Molecular Formula | C36H33N5O5S |
| Molecular Weight | 647.76 g/mol |
| Exact Mass | 647.22 |
| IUPAC Name | 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CSc2nnnn2C)O[C@H](c2ccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C36H33N5O5S/c1-22-31(21-47-36-37-38-39-40(36)2)45-35(46-32(22)26-12-10-23(20-42)11-13-26)27-16-14-25(15-17-27)28-7-5-6-24(18-28)19-41-33(43)29-8-3-4-9-30(29)34(41)44/h3-18,22,31-32,35,42H,19-21H2,1-2H3/t22-,31+,32+,35+/m1/s1 |
| InChIKey | GKIMNDYPJOFLTR-NGRLTGPUSA-N |
| XLogP | 5.75 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.76 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|