C37H34N4O5S — CID 6682961
2-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6682961) has the molecular formula C37H34N4O5S and a molecular weight of 646.77 g/mol. Its IUPAC name is 2-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6682961 |
| Molecular Formula | C37H34N4O5S |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | 2-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@H]1[C@@H](CSc2nncn2C)O[C@@H](c2ccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C37H34N4O5S/c1-23-32(21-47-37-39-38-22-40(37)2)45-36(46-33(23)27-12-10-24(20-42)11-13-27)28-16-14-26(15-17-28)29-7-5-6-25(18-29)19-41-34(43)30-8-3-4-9-31(30)35(41)44/h3-18,22-23,32-33,36,42H,19-21H2,1-2H3/t23-,32+,33+,36+/m0/s1 |
| InChIKey | BLJZZUJYYWASDX-VUYYBYLHSA-N |
| XLogP | 6.35 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|