C32H29N3O5S — CID 6682595
2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6682595) has the molecular formula C32H29N3O5S and a molecular weight of 567.67 g/mol. Its IUPAC name is 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6682595 |
| Molecular Formula | C32H29N3O5S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@H]1[C@@H](CSc2ncccn2)O[C@@H](c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C32H29N3O5S/c1-20-27(19-41-32-33-15-4-16-34-32)39-31(40-28(20)23-11-9-22(18-36)10-12-23)24-13-7-21(8-14-24)17-35-29(37)25-5-2-3-6-26(25)30(35)38/h2-16,20,27-28,31,36H,17-19H2,1H3/t20-,27+,28+,31+/m0/s1 |
| InChIKey | KOYOAPIBSNKDLB-JTWMPTDZSA-N |
| XLogP | 5.35 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|