C35H40N2O5 — CID 6682709
2-[[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6682709) has the molecular formula C35H40N2O5 and a molecular weight of 568.71 g/mol. Its IUPAC name is 2-[[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6682709 |
| Molecular Formula | C35H40N2O5 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 2-[[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@H]1[C@@H](CN2CCCCCCC2)O[C@@H](c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H40N2O5/c1-24-31(22-36-19-7-3-2-4-8-20-36)41-35(42-32(24)27-15-13-26(23-38)14-16-27)28-17-11-25(12-18-28)21-37-33(39)29-9-5-6-10-30(29)34(37)40/h5-6,9-18,24,31-32,35,38H,2-4,7-8,19-23H2,1H3/t24-,31+,32+,35+/m0/s1 |
| InChIKey | FEIYKZKMFMJBLR-IFLHRNKNSA-N |
| XLogP | 6.03 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|