C39H39ClN2O6 — CID 6686614
2-[[4-[(2S,4S,5R,6R)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6686614) has the molecular formula C39H39ClN2O6 and a molecular weight of 667.20 g/mol. Its IUPAC name is 2-[[4-[(2S,4S,5R,6R)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(2S,4S,5R,6R)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6686614 |
| Molecular Formula | C39H39ClN2O6 |
| Molecular Weight | 667.20 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | 2-[[4-[(2S,4S,5R,6R)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@H]1[C@@H](CN2CCC(O)(c3ccc(Cl)cc3)CC2)O[C@@H](c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C39H39ClN2O6/c1-25-34(23-41-20-18-39(46,19-21-41)30-14-16-31(40)17-15-30)47-38(48-35(25)28-10-8-27(24-43)9-11-28)29-12-6-26(7-13-29)22-42-36(44)32-4-2-3-5-33(32)37(42)45/h2-17,25,34-35,38,43,46H,18-24H2,1H3/t25-,34+,35+,38+/m0/s1 |
| InChIKey | GRLABWYHWAGBGL-GVFODBJCSA-N |
| XLogP | 6.40 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.20 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|