C38H39N3O5 — CID 6705911
2-[4-[(2R,4R,5S,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6705911) has the molecular formula C38H39N3O5 and a molecular weight of 617.75 g/mol. Its IUPAC name is 2-[4-[(2R,4R,5S,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2R,4R,5S,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6705911 |
| Molecular Formula | C38H39N3O5 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | 2-[4-[(2R,4R,5S,6S)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CN2CCN(Cc3ccccc3)CC2)O[C@H](c2ccc(N3C(=O)c4ccccc4C3=O)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C38H39N3O5/c1-26-34(24-40-21-19-39(20-22-40)23-27-7-3-2-4-8-27)45-38(46-35(26)29-13-11-28(25-42)12-14-29)30-15-17-31(18-16-30)41-36(43)32-9-5-6-10-33(32)37(41)44/h2-18,26,34-35,38,42H,19-25H2,1H3/t26-,34+,35+,38+/m1/s1 |
| InChIKey | QRPGOLHFIVMMBK-IQOKRNNPSA-N |
| XLogP | 5.59 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|