C30H37N3O3 — CID 4147544
[4-[2-(3-aminophenyl)-6-[(4-benzylpiperazin-1-yl)methyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 4147544) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is [4-[2-(3-aminophenyl)-6-[(4-benzylpiperazin-1-yl)methyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[2-(3-aminophenyl)-6-[(4-benzylpiperazin-1-yl)methyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 4147544 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | [4-[2-(3-aminophenyl)-6-[(4-benzylpiperazin-1-yl)methyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | CC1C(CN2CCN(Cc3ccccc3)CC2)OC(c2cccc(N)c2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C30H37N3O3/c1-22-28(20-33-16-14-32(15-17-33)19-23-6-3-2-4-7-23)35-30(26-8-5-9-27(31)18-26)36-29(22)25-12-10-24(21-34)11-13-25/h2-13,18,22,28-30,34H,14-17,19-21,31H2,1H3 |
| InChIKey | RQHUQZZWQSGTRM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|