C29H34N4O5 — CID 6686462
[4-[(2S,4R,5R,6S)-2-(3-aminophenyl)-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6686462) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is [4-[(2S,4R,5R,6S)-2-(3-aminophenyl)-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2S,4R,5R,6S)-2-(3-aminophenyl)-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6686462 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | [4-[(2S,4R,5R,6S)-2-(3-aminophenyl)-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(N)c2)O[C@@H]1CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C29H34N4O5/c1-20-27(18-31-13-15-32(16-14-31)25-9-11-26(12-10-25)33(35)36)37-29(23-3-2-4-24(30)17-23)38-28(20)22-7-5-21(19-34)6-8-22/h2-12,17,20,27-29,34H,13-16,18-19,30H2,1H3/t20-,27+,28?,29+/m0/s1 |
| InChIKey | CSWPEDNKZVWCDK-VDHFQNMMSA-N |
| XLogP | 4.28 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|