C23H30N2O4 — CID 6687610
[4-[(2R,4S,5S,6R)-2-(3-aminophenyl)-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6687610) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is [4-[(2R,4S,5S,6R)-2-(3-aminophenyl)-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2R,4S,5S,6R)-2-(3-aminophenyl)-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6687610 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [4-[(2R,4S,5S,6R)-2-(3-aminophenyl)-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(N)c2)O[C@H]1CN1CCOCC1 |
| InChI | InChI=1S/C23H30N2O4/c1-16-21(14-25-9-11-27-12-10-25)28-23(19-3-2-4-20(24)13-19)29-22(16)18-7-5-17(15-26)6-8-18/h2-8,13,16,21-23,26H,9-12,14-15,24H2,1H3/t16-,21+,22?,23+/m1/s1 |
| InChIKey | ZNBKNVQXCLGSBL-KSQRMEKGSA-N |
| XLogP | 2.88 |
| TPSA | 77.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|