C36H40N4O5 — CID 6686508
[4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6686508) has the molecular formula C36H40N4O5 and a molecular weight of 608.74 g/mol. Its IUPAC name is [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6686508 |
| Molecular Formula | C36H40N4O5 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | [4-[(2S,4R,5R,6S)-2-[4-[3-(aminomethyl)phenyl]phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CN)c3)cc2)O[C@@H]1CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C36H40N4O5/c1-25-34(23-38-17-19-39(20-18-38)32-13-15-33(16-14-32)40(42)43)44-36(45-35(25)29-7-5-26(24-41)6-8-29)30-11-9-28(10-12-30)31-4-2-3-27(21-31)22-37/h2-16,21,25,34-36,41H,17-20,22-24,37H2,1H3/t25-,34+,35?,36+/m0/s1 |
| InChIKey | FVNKINBRWSGQLS-ODJQXFFFSA-N |
| XLogP | 5.83 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|