C40H44N4O7 — CID 3429625
prop-2-enyl N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate (PubChem CID 3429625) has the molecular formula C40H44N4O7 and a molecular weight of 692.81 g/mol. Its IUPAC name is prop-2-enyl N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 3429625 |
| Molecular Formula | C40H44N4O7 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 692.32 |
| IUPAC Name | prop-2-enyl N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1cccc(-c2ccc(C3OC(CN4CCN(c5ccc([N+](=O)[O-])cc5)CC4)C(C)C(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C40H44N4O7/c1-3-23-49-40(46)41-25-30-5-4-6-34(24-30)31-11-13-33(14-12-31)39-50-37(28(2)38(51-39)32-9-7-29(27-45)8-10-32)26-42-19-21-43(22-20-42)35-15-17-36(18-16-35)44(47)48/h3-18,24,28,37-39,45H,1,19-23,25-27H2,2H3,(H,41,46) |
| InChIKey | DLJAFFJBGXTEMR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|