C33H41N5O6 — CID 6686502
1-ethyl-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6686502) has the molecular formula C33H41N5O6 and a molecular weight of 603.72 g/mol. Its IUPAC name is 1-ethyl-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6686502 |
| Molecular Formula | C33H41N5O6 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | 1-ethyl-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | CCNC(=O)NCc1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)O2)cc1 |
| InChI | InChI=1S/C33H41N5O6/c1-3-34-33(40)35-20-24-4-10-27(11-5-24)32-43-30(23(2)31(44-32)26-8-6-25(22-39)7-9-26)21-36-16-18-37(19-17-36)28-12-14-29(15-13-28)38(41)42/h4-15,23,30-32,39H,3,16-22H2,1-2H3,(H2,34,35,40)/t23-,30+,31?,32+/m0/s1 |
| InChIKey | QUNWDPUTCCFTEM-CBNIBAFZSA-N |
| XLogP | 4.52 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|