C39H40N6O6 — CID 6686494
N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]quinoxaline-2-carboxamide (PubChem CID 6686494) has the molecular formula C39H40N6O6 and a molecular weight of 688.79 g/mol. Its IUPAC name is N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6686494 |
| Molecular Formula | C39H40N6O6 |
| Molecular Weight | 688.79 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]quinoxaline-2-carboxamide |
| SMILES | C[C@H]1[C@@H](CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)O[C@@H](c2ccc(CNC(=O)c3cnc4ccccc4n3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C39H40N6O6/c1-26-36(24-43-18-20-44(21-19-43)31-14-16-32(17-15-31)45(48)49)50-39(51-37(26)29-10-8-28(25-46)9-11-29)30-12-6-27(7-13-30)22-41-38(47)35-23-40-33-4-2-3-5-34(33)42-35/h2-17,23,26,36-37,39,46H,18-22,24-25H2,1H3,(H,41,47)/t26-,36+,37+,39+/m0/s1 |
| InChIKey | XTUPMGUOXDXTRV-RVUXUFOTSA-N |
| XLogP | 5.57 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.79 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|