C43H45N5O7 — CID 6686505
1-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6686505) has the molecular formula C43H45N5O7 and a molecular weight of 743.86 g/mol. Its IUPAC name is 1-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6686505 |
| Molecular Formula | C43H45N5O7 |
| Molecular Weight | 743.86 g/mol |
| Exact Mass | 743.33 |
| IUPAC Name | 1-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)Nc3ccc(Oc4ccccc4)cc3)cc2)O[C@@H]1CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C43H45N5O7/c1-30-40(28-46-23-25-47(26-24-46)36-17-19-37(20-18-36)48(51)52)54-42(55-41(30)33-11-9-32(29-49)10-12-33)34-13-7-31(8-14-34)27-44-43(50)45-35-15-21-39(22-16-35)53-38-5-3-2-4-6-38/h2-22,30,40-42,49H,23-29H2,1H3,(H2,44,45,50)/t30-,40+,41?,42+/m0/s1 |
| InChIKey | DLMGWKDFHHKBQG-WGJYZXLUSA-N |
| XLogP | 7.81 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.86 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|