C43H45N3O6 — CID 6681934
1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6681934) has the molecular formula C43H45N3O6 and a molecular weight of 699.85 g/mol. Its IUPAC name is 1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6681934 |
| Molecular Formula | C43H45N3O6 |
| Molecular Weight | 699.85 g/mol |
| Exact Mass | 699.33 |
| IUPAC Name | 1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CNC(=O)Nc4ccc(Oc5ccccc5)cc4)c3)cc2)O[C@@H]1CN1CCOCC1 |
| InChI | InChI=1S/C43H45N3O6/c1-30-40(28-46-22-24-49-25-23-46)51-42(52-41(30)34-12-10-31(29-47)11-13-34)35-16-14-33(15-17-35)36-7-5-6-32(26-36)27-44-43(48)45-37-18-20-39(21-19-37)50-38-8-3-2-4-9-38/h2-21,26,30,40-42,47H,22-25,27-29H2,1H3,(H2,44,45,48)/t30-,40+,41?,42+/m0/s1 |
| InChIKey | KJJIPLLXVVZXMF-WGJYZXLUSA-N |
| XLogP | 8.08 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.85 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |