C42H38Cl2N4O5 — CID 6684047
1-[[3-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6684047) has the molecular formula C42H38Cl2N4O5 and a molecular weight of 749.70 g/mol. Its IUPAC name is 1-[[3-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[[3-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6684047 |
| Molecular Formula | C42H38Cl2N4O5 |
| Molecular Weight | 749.70 g/mol |
| Exact Mass | 748.22 |
| IUPAC Name | 1-[[3-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(-c3cccc(CNC(=O)Nc4ccc(Oc5ccccc5)cc4)c3)c2)O[C@@H]1Cn1cnc(Cl)c1Cl |
| InChI | InChI=1S/C42H38Cl2N4O5/c1-27-37(24-48-26-46-39(43)40(48)44)52-41(53-38(27)30-15-13-28(25-49)14-16-30)33-10-6-9-32(22-33)31-8-5-7-29(21-31)23-45-42(50)47-34-17-19-36(20-18-34)51-35-11-3-2-4-12-35/h2-22,26-27,37-38,41,49H,23-25H2,1H3,(H2,45,47,50)/t27-,37+,38?,41+/m0/s1 |
| InChIKey | OIKMNTHLJZKIKX-XUNBNHGESA-N |
| XLogP | 9.95 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.70 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |