C34H35Cl2N3O6 — CID 6684040
5-[[3-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6684040) has the molecular formula C34H35Cl2N3O6 and a molecular weight of 652.58 g/mol. Its IUPAC name is 5-[[3-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[3-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6684040 |
| Molecular Formula | C34H35Cl2N3O6 |
| Molecular Weight | 652.58 g/mol |
| Exact Mass | 651.19 |
| IUPAC Name | 5-[[3-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(-c3cccc(CNC(=O)CCCC(=O)O)c3)c2)O[C@@H]1Cn1cnc(Cl)c1Cl |
| InChI | InChI=1S/C34H35Cl2N3O6/c1-21-28(18-39-20-38-32(35)33(39)36)44-34(45-31(21)24-13-11-22(19-40)12-14-24)27-8-3-7-26(16-27)25-6-2-5-23(15-25)17-37-29(41)9-4-10-30(42)43/h2-3,5-8,11-16,20-21,28,31,34,40H,4,9-10,17-19H2,1H3,(H,37,41)(H,42,43)/t21-,28+,31?,34+/m0/s1 |
| InChIKey | WQZORDFAUZVNFW-GENWJBLLSA-N |
| XLogP | 6.71 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |