C31H38Cl2N4O5 — CID 6689718
6-acetamido-N-[[4-[(2R,4R,5S,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide (PubChem CID 6689718) has the molecular formula C31H38Cl2N4O5 and a molecular weight of 617.57 g/mol. Its IUPAC name is 6-acetamido-N-[[4-[(2R,4R,5S,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[4-[(2R,4R,5S,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6689718 |
| Molecular Formula | C31H38Cl2N4O5 |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | 6-acetamido-N-[[4-[(2R,4R,5S,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1ccc([C@H]2O[C@@H](Cn3cnc(Cl)c3Cl)[C@@H](C)[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C31H38Cl2N4O5/c1-20-26(17-37-19-36-29(32)30(37)33)41-31(42-28(20)24-11-9-23(18-38)10-12-24)25-13-7-22(8-14-25)16-35-27(40)6-4-3-5-15-34-21(2)39/h7-14,19-20,26,28,31,38H,3-6,15-18H2,1-2H3,(H,34,39)(H,35,40)/t20-,26+,28+,31+/m1/s1 |
| InChIKey | SNPJNGIAWJKMSY-NEHDKYRSSA-N |
| XLogP | 5.49 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|