C35H51N3O5 — CID 6682711
6-acetamido-N-[[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide (PubChem CID 6682711) has the molecular formula C35H51N3O5 and a molecular weight of 593.81 g/mol. Its IUPAC name is 6-acetamido-N-[[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6682711 |
| Molecular Formula | C35H51N3O5 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | 6-acetamido-N-[[4-[(2S,4S,5R,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1ccc([C@@H]2O[C@H](CN3CCCCCCC3)[C@H](C)[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C35H51N3O5/c1-26-32(24-38-21-9-4-3-5-10-22-38)42-35(43-34(26)30-16-14-29(25-39)15-17-30)31-18-12-28(13-19-31)23-37-33(41)11-7-6-8-20-36-27(2)40/h12-19,26,32,34-35,39H,3-11,20-25H2,1-2H3,(H,36,40)(H,37,41)/t26-,32+,34+,35+/m0/s1 |
| InChIKey | XNLGQWDZOCWNHB-YFEKPHGUSA-N |
| XLogP | 5.55 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|