C41H55N3O5 — CID 3606751
6-acetamido-N-[[3-[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 3606751) has the molecular formula C41H55N3O5 and a molecular weight of 669.91 g/mol. Its IUPAC name is 6-acetamido-N-[[3-[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[3-[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 3606751 |
| Molecular Formula | C41H55N3O5 |
| Molecular Weight | 669.91 g/mol |
| Exact Mass | 669.41 |
| IUPAC Name | 6-acetamido-N-[[3-[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1cccc(-c2ccc(C3OC(CN4CCCCCCC4)C(C)C(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C41H55N3O5/c1-30-38(28-44-24-9-4-3-5-10-25-44)48-41(49-40(30)35-17-15-32(29-45)16-18-35)36-21-19-34(20-22-36)37-13-11-12-33(26-37)27-43-39(47)14-7-6-8-23-42-31(2)46/h11-13,15-22,26,30,38,40-41,45H,3-10,14,23-25,27-29H2,1-2H3,(H,42,46)(H,43,47) |
| InChIKey | GWLYPZNDMGFEHP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.91 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|