C32H45N3O5 — CID 3394116
6-acetamido-N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide (PubChem CID 3394116) has the molecular formula C32H45N3O5 and a molecular weight of 551.73 g/mol. Its IUPAC name is 6-acetamido-N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide.
| Compound Name | 6-acetamido-N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 3394116 |
| Molecular Formula | C32H45N3O5 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | 6-acetamido-N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1ccc(C2OC(CN3CCCCC3)C(C)C(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C32H45N3O5/c1-23-29(21-35-19-7-4-8-20-35)39-32(40-31(23)26-12-10-25(22-36)11-13-26)27-14-16-28(17-15-27)34-30(38)9-5-3-6-18-33-24(2)37/h10-17,23,29,31-32,36H,3-9,18-22H2,1-2H3,(H,33,37)(H,34,38) |
| InChIKey | KTYYWMNTLMSVBK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|