C36H51N3O7 — CID 6705891
tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(6-acetamidohexanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 6705891) has the molecular formula C36H51N3O7 and a molecular weight of 637.82 g/mol. Its IUPAC name is tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(6-acetamidohexanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(6-acetamidohexanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6705891 |
| Molecular Formula | C36H51N3O7 |
| Molecular Weight | 637.82 g/mol |
| Exact Mass | 637.37 |
| IUPAC Name | tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(6-acetamidohexanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | CC(=O)NCCCCCC(=O)Nc1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN3CCC[C@H]3C(=O)OC(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C36H51N3O7/c1-24-31(22-39-21-9-10-30(39)34(43)46-36(3,4)5)44-35(45-33(24)27-14-12-26(23-40)13-15-27)28-16-18-29(19-17-28)38-32(42)11-7-6-8-20-37-25(2)41/h12-19,24,30-31,33,35,40H,6-11,20-23H2,1-5H3,(H,37,41)(H,38,42)/t24-,30+,31+,33?,35+/m1/s1 |
| InChIKey | YBBSVOPTWGWOOB-ONWXCAHMSA-N |
| XLogP | 5.41 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.82 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|