C35H37F5N2O6 — CID 4280397
tert-butyl 1-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 4280397) has the molecular formula C35H37F5N2O6 and a molecular weight of 676.68 g/mol. Its IUPAC name is tert-butyl 1-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 1-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 4280397 |
| Molecular Formula | C35H37F5N2O6 |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | tert-butyl 1-[[6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | CC1C(CN2CCCC2C(=O)OC(C)(C)C)OC(c2ccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H37F5N2O6/c1-18-24(16-42-15-5-6-23(42)33(45)48-35(2,3)4)46-34(47-31(18)20-9-7-19(17-43)8-10-20)21-11-13-22(14-12-21)41-32(44)25-26(36)28(38)30(40)29(39)27(25)37/h7-14,18,23-24,31,34,43H,5-6,15-17H2,1-4H3,(H,41,44) |
| InChIKey | ZCLNONMOGSNPLB-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|