C36H40N2O7 — CID 6705889
tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 6705889) has the molecular formula C36H40N2O7 and a molecular weight of 612.72 g/mol. Its IUPAC name is tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6705889 |
| Molecular Formula | C36H40N2O7 |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@@H]1[C@H](CN2CCC[C@H]2C(=O)OC(C)(C)C)O[C@H](c2ccc(N3C(=O)c4ccccc4C3=O)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C36H40N2O7/c1-22-30(20-37-19-7-10-29(37)34(42)45-36(2,3)4)43-35(44-31(22)24-13-11-23(21-39)12-14-24)25-15-17-26(18-16-25)38-32(40)27-8-5-6-9-28(27)33(38)41/h5-6,8-9,11-18,22,29-31,35,39H,7,10,19-21H2,1-4H3/t22-,29+,30+,31+,35+/m1/s1 |
| InChIKey | MMTPICHMAMDBNR-MVYIRVJISA-N |
| XLogP | 5.58 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|