C34H42N2O7S — CID 6705880
tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(benzenesulfonamido)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 6705880) has the molecular formula C34H42N2O7S and a molecular weight of 622.78 g/mol. Its IUPAC name is tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(benzenesulfonamido)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(benzenesulfonamido)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6705880 |
| Molecular Formula | C34H42N2O7S |
| Molecular Weight | 622.78 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[4-(benzenesulfonamido)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(NS(=O)(=O)c3ccccc3)cc2)O[C@H]1CN1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H42N2O7S/c1-23-30(21-36-20-8-11-29(36)32(38)43-34(2,3)4)41-33(42-31(23)25-14-12-24(22-37)13-15-25)26-16-18-27(19-17-26)35-44(39,40)28-9-6-5-7-10-28/h5-7,9-10,12-19,23,29-31,33,35,37H,8,11,20-22H2,1-4H3/t23-,29+,30+,31?,33+/m1/s1 |
| InChIKey | YVGQGXQNRGBZGO-JFJBDMLKSA-N |
| XLogP | 5.58 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.78 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |