C41H48N2O7S — CID 6691385
tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[3-[3-(benzenesulfonamidomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 6691385) has the molecular formula C41H48N2O7S and a molecular weight of 712.91 g/mol. Its IUPAC name is tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[3-[3-(benzenesulfonamidomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[3-[3-(benzenesulfonamidomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6691385 |
| Molecular Formula | C41H48N2O7S |
| Molecular Weight | 712.91 g/mol |
| Exact Mass | 712.32 |
| IUPAC Name | tert-butyl (2S)-1-[[(2R,4R,5S,6S)-2-[3-[3-(benzenesulfonamidomethyl)phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNS(=O)(=O)c4ccccc4)c3)c2)O[C@H]1CN1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H48N2O7S/c1-28-37(26-43-22-10-17-36(43)39(45)50-41(2,3)4)48-40(49-38(28)31-20-18-29(27-44)19-21-31)34-14-9-13-33(24-34)32-12-8-11-30(23-32)25-42-51(46,47)35-15-6-5-7-16-35/h5-9,11-16,18-21,23-24,28,36-38,40,42,44H,10,17,22,25-27H2,1-4H3/t28-,36+,37+,38?,40+/m1/s1 |
| InChIKey | MPSRNJSIZQJQHF-TWZFQSBGSA-N |
| XLogP | 6.92 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.91 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |