C36H40N2O6S — CID 6687822
N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide (PubChem CID 6687822) has the molecular formula C36H40N2O6S and a molecular weight of 628.79 g/mol. Its IUPAC name is N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6687822 |
| Molecular Formula | C36H40N2O6S |
| Molecular Weight | 628.79 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNS(=O)(=O)c4ccccc4)c3)c2)O[C@H]1CN1CC[C@H](O)C1 |
| InChI | InChI=1S/C36H40N2O6S/c1-25-34(23-38-18-17-32(40)22-38)43-36(44-35(25)28-15-13-26(24-39)14-16-28)31-10-6-9-30(20-31)29-8-5-7-27(19-29)21-37-45(41,42)33-11-3-2-4-12-33/h2-16,19-20,25,32,34-37,39-40H,17-18,21-24H2,1H3/t25-,32+,34+,35?,36+/m1/s1 |
| InChIKey | FFVCQPWJBHCOIK-VDEMRTLSSA-N |
| XLogP | 5.18 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.79 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |