C32H35Cl3N2O5 — CID 6682077
2,2,2-trichloro-N-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6682077) has the molecular formula C32H35Cl3N2O5 and a molecular weight of 634.00 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6682077 |
| Molecular Formula | C32H35Cl3N2O5 |
| Molecular Weight | 634.00 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | 2,2,2-trichloro-N-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(-c3cccc(CNC(=O)C(Cl)(Cl)Cl)c3)c2)O[C@@H]1CN1CC[C@H](O)C1 |
| InChI | InChI=1S/C32H35Cl3N2O5/c1-20-28(18-37-13-12-27(39)17-37)41-30(42-29(20)23-10-8-21(19-38)9-11-23)26-7-3-6-25(15-26)24-5-2-4-22(14-24)16-36-31(40)32(33,34)35/h2-11,14-15,20,27-30,38-39H,12-13,16-19H2,1H3,(H,36,40)/t20-,27-,28+,29?,30+/m0/s1 |
| InChIKey | BPURGHBQFQJPIJ-VMCMSPQNSA-N |
| XLogP | 5.69 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.00 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|