C30H32Cl3NO5S — CID 6687476
2,2,2-trichloro-N-[[3-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6687476) has the molecular formula C30H32Cl3NO5S and a molecular weight of 625.01 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[3-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[3-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6687476 |
| Molecular Formula | C30H32Cl3NO5S |
| Molecular Weight | 625.01 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | 2,2,2-trichloro-N-[[3-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)C(Cl)(Cl)Cl)c3)c2)O[C@H]1CSCCO |
| InChI | InChI=1S/C30H32Cl3NO5S/c1-19-26(18-40-13-12-35)38-28(39-27(19)22-10-8-20(17-36)9-11-22)25-7-3-6-24(15-25)23-5-2-4-21(14-23)16-34-29(37)30(31,32)33/h2-11,14-15,19,26-28,35-36H,12-13,16-18H2,1H3,(H,34,37)/t19-,26+,27?,28+/m1/s1 |
| InChIKey | KYBGAAQYRTYLKH-VMLNKLAZSA-N |
| XLogP | 6.35 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.01 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|