C30H30Cl3N5O4S — CID 6688968
2,2,2-trichloro-N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6688968) has the molecular formula C30H30Cl3N5O4S and a molecular weight of 663.03 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6688968 |
| Molecular Formula | C30H30Cl3N5O4S |
| Molecular Weight | 663.03 g/mol |
| Exact Mass | 661.11 |
| IUPAC Name | 2,2,2-trichloro-N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)C(Cl)(Cl)Cl)c3)c2)O[C@H]1CSc1nnnn1C |
| InChI | InChI=1S/C30H30Cl3N5O4S/c1-18-25(17-43-29-35-36-37-38(29)2)41-27(42-26(18)21-11-9-19(16-39)10-12-21)24-8-4-7-23(14-24)22-6-3-5-20(13-22)15-34-28(40)30(31,32)33/h3-14,18,25-27,39H,15-17H2,1-2H3,(H,34,40)/t18-,25+,26?,27+/m1/s1 |
| InChIKey | RXFAMUHBSCEQQS-LKQMTDIBSA-N |
| XLogP | 5.94 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.03 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|