C35H32Cl3N5O4S — CID 6685821
2,2,2-trichloro-N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6685821) has the molecular formula C35H32Cl3N5O4S and a molecular weight of 725.10 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6685821 |
| Molecular Formula | C35H32Cl3N5O4S |
| Molecular Weight | 725.10 g/mol |
| Exact Mass | 723.12 |
| IUPAC Name | 2,2,2-trichloro-N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CNC(=O)C(Cl)(Cl)Cl)c3)cc2)O[C@@H]1CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C35H32Cl3N5O4S/c1-22-30(21-48-34-40-41-42-43(34)29-8-3-2-4-9-29)46-32(47-31(22)26-12-10-23(20-44)11-13-26)27-16-14-25(15-17-27)28-7-5-6-24(18-28)19-39-33(45)35(36,37)38/h2-18,22,30-32,44H,19-21H2,1H3,(H,39,45)/t22-,30+,31?,32+/m0/s1 |
| InChIKey | RAHJVNONWVRNBX-YUZUQUAVSA-N |
| XLogP | 7.39 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.10 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|