C28H26Cl3N5O4S — CID 6685775
2,2,2-trichloro-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6685775) has the molecular formula C28H26Cl3N5O4S and a molecular weight of 634.97 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6685775 |
| Molecular Formula | C28H26Cl3N5O4S |
| Molecular Weight | 634.97 g/mol |
| Exact Mass | 633.08 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)C(Cl)(Cl)Cl)c2)O[C@@H]1CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C28H26Cl3N5O4S/c1-17-23(16-41-27-33-34-35-36(27)22-8-3-2-4-9-22)39-25(40-24(17)19-12-10-18(15-37)11-13-19)20-6-5-7-21(14-20)32-26(38)28(29,30)31/h2-14,17,23-25,37H,15-16H2,1H3,(H,32,38)/t17-,23+,24?,25+/m0/s1 |
| InChIKey | OJEMKUIMDPSWKR-USFXIKCVSA-N |
| XLogP | 6.05 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.97 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|