C30H31N5O6S — CID 6691530
4-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid (PubChem CID 6691530) has the molecular formula C30H31N5O6S and a molecular weight of 589.67 g/mol. Its IUPAC name is 4-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6691530 |
| Molecular Formula | C30H31N5O6S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | 4-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)CCC(=O)O)c2)O[C@H]1CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C30H31N5O6S/c1-19-25(18-42-30-32-33-34-35(30)24-8-3-2-4-9-24)40-29(41-28(19)21-12-10-20(17-36)11-13-21)22-6-5-7-23(16-22)31-26(37)14-15-27(38)39/h2-13,16,19,25,28-29,36H,14-15,17-18H2,1H3,(H,31,37)(H,38,39)/t19-,25+,28?,29+/m1/s1 |
| InChIKey | AFGKOLKSZBOBCP-PVPBFIMESA-N |
| XLogP | 4.54 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |