C34H40N6O5S — CID 6685789
6-acetamido-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanamide (PubChem CID 6685789) has the molecular formula C34H40N6O5S and a molecular weight of 644.80 g/mol. Its IUPAC name is 6-acetamido-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanamide.
| Compound Name | 6-acetamido-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 6685789 |
| Molecular Formula | C34H40N6O5S |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 6-acetamido-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1cccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3nnnn3-c3ccccc3)O2)c1 |
| InChI | InChI=1S/C34H40N6O5S/c1-23-30(22-46-34-37-38-39-40(34)29-12-5-3-6-13-29)44-33(45-32(23)26-17-15-25(21-41)16-18-26)27-10-9-11-28(20-27)36-31(43)14-7-4-8-19-35-24(2)42/h3,5-6,9-13,15-18,20,23,30,32-33,41H,4,7-8,14,19,21-22H2,1-2H3,(H,35,42)(H,36,43)/t23-,30+,32?,33+/m0/s1 |
| InChIKey | BPVLFJRYPWWHIN-FDIAVVAJSA-N |
| XLogP | 5.37 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|