C32H39N3O5S — CID 6682459
6-acetamido-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide (PubChem CID 6682459) has the molecular formula C32H39N3O5S and a molecular weight of 577.75 g/mol. Its IUPAC name is 6-acetamido-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide.
| Compound Name | 6-acetamido-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 6682459 |
| Molecular Formula | C32H39N3O5S |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 6-acetamido-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1cccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3ccccn3)O2)c1 |
| InChI | InChI=1S/C32H39N3O5S/c1-22-28(21-41-30-12-5-7-18-34-30)39-32(40-31(22)25-15-13-24(20-36)14-16-25)26-9-8-10-27(19-26)35-29(38)11-4-3-6-17-33-23(2)37/h5,7-10,12-16,18-19,22,28,31-32,36H,3-4,6,11,17,20-21H2,1-2H3,(H,33,37)(H,35,38)/t22-,28+,31?,32+/m0/s1 |
| InChIKey | ZICKDUKGEBGNFP-HJSUVWJLSA-N |
| XLogP | 5.79 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|