C35H36N2O6S — CID 6682547
4-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 6682547) has the molecular formula C35H36N2O6S and a molecular weight of 612.75 g/mol. Its IUPAC name is 4-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6682547 |
| Molecular Formula | C35H36N2O6S |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 4-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(-c3cccc(CNC(=O)CCC(=O)O)c3)c2)O[C@@H]1CSc1ccccn1 |
| InChI | InChI=1S/C35H36N2O6S/c1-23-30(22-44-32-10-2-3-17-36-32)42-35(43-34(23)26-13-11-24(21-38)12-14-26)29-9-5-8-28(19-29)27-7-4-6-25(18-27)20-37-31(39)15-16-33(40)41/h2-14,17-19,23,30,34-35,38H,15-16,20-22H2,1H3,(H,37,39)(H,40,41)/t23-,30+,34?,35+/m0/s1 |
| InChIKey | IJLWJAKCXUEJMF-KGBVDZLSSA-N |
| XLogP | 6.31 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |