C37H37NO8S — CID 6684683
2-[[(2S,4S,5R,6R)-2-[4-[3-[(3-carboxypropanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6684683) has the molecular formula C37H37NO8S and a molecular weight of 655.77 g/mol. Its IUPAC name is 2-[[(2S,4S,5R,6R)-2-[4-[3-[(3-carboxypropanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[(2S,4S,5R,6R)-2-[4-[3-[(3-carboxypropanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6684683 |
| Molecular Formula | C37H37NO8S |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.22 |
| IUPAC Name | 2-[[(2S,4S,5R,6R)-2-[4-[3-[(3-carboxypropanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CNC(=O)CCC(=O)O)c3)cc2)O[C@@H]1CSc1ccccc1C(=O)O |
| InChI | InChI=1S/C37H37NO8S/c1-23-31(22-47-32-8-3-2-7-30(32)36(43)44)45-37(46-35(23)27-11-9-24(21-39)10-12-27)28-15-13-26(14-16-28)29-6-4-5-25(19-29)20-38-33(40)17-18-34(41)42/h2-16,19,23,31,35,37,39H,17-18,20-22H2,1H3,(H,38,40)(H,41,42)(H,43,44)/t23-,31+,35?,37+/m0/s1 |
| InChIKey | UKJXTUCVEQTMOR-DYZQFRNWSA-N |
| XLogP | 6.61 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |