C38H41NO7S — CID 6684224
5-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6684224) has the molecular formula C38H41NO7S and a molecular weight of 655.81 g/mol. Its IUPAC name is 5-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6684224 |
| Molecular Formula | C38H41NO7S |
| Molecular Weight | 655.81 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | 5-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | COc1ccccc1SC[C@H]1O[C@@H](c2ccc(-c3cccc(CNC(=O)CCCC(=O)O)c3)cc2)OC(c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C38H41NO7S/c1-25-33(24-47-34-10-4-3-9-32(34)44-2)45-38(46-37(25)29-15-13-26(23-40)14-16-29)30-19-17-28(18-20-30)31-8-5-7-27(21-31)22-39-35(41)11-6-12-36(42)43/h3-5,7-10,13-21,25,33,37-38,40H,6,11-12,22-24H2,1-2H3,(H,39,41)(H,42,43)/t25-,33+,37?,38+/m0/s1 |
| InChIKey | ZCVHLSOSKRUCJZ-ZVPQMJIXSA-N |
| XLogP | 7.31 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.81 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |