C38H39NO8S — CID 6690589
4-[[(2R,4R,5S,6S)-2-[3-[3-[(4-carboxybutanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6690589) has the molecular formula C38H39NO8S and a molecular weight of 669.80 g/mol. Its IUPAC name is 4-[[(2R,4R,5S,6S)-2-[3-[3-[(4-carboxybutanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,5S,6S)-2-[3-[3-[(4-carboxybutanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6690589 |
| Molecular Formula | C38H39NO8S |
| Molecular Weight | 669.80 g/mol |
| Exact Mass | 669.24 |
| IUPAC Name | 4-[[(2R,4R,5S,6S)-2-[3-[3-[(4-carboxybutanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)CCCC(=O)O)c3)c2)O[C@H]1CSc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C38H39NO8S/c1-24-33(23-48-32-17-15-28(16-18-32)37(44)45)46-38(47-36(24)27-13-11-25(22-40)12-14-27)31-8-3-7-30(20-31)29-6-2-5-26(19-29)21-39-34(41)9-4-10-35(42)43/h2-3,5-8,11-20,24,33,36,38,40H,4,9-10,21-23H2,1H3,(H,39,41)(H,42,43)(H,44,45)/t24-,33+,36?,38+/m1/s1 |
| InChIKey | FATCQSAADBKAFO-UVSSHPDTSA-N |
| XLogP | 7.00 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.80 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |