C41H46N2O7S — CID 6684801
4-[[(2S,4S,5R,6R)-2-[4-[3-[(6-acetamidohexanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6684801) has the molecular formula C41H46N2O7S and a molecular weight of 710.89 g/mol. Its IUPAC name is 4-[[(2S,4S,5R,6R)-2-[4-[3-[(6-acetamidohexanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2S,4S,5R,6R)-2-[4-[3-[(6-acetamidohexanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6684801 |
| Molecular Formula | C41H46N2O7S |
| Molecular Weight | 710.89 g/mol |
| Exact Mass | 710.30 |
| IUPAC Name | 4-[[(2S,4S,5R,6R)-2-[4-[3-[(6-acetamidohexanoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | CC(=O)NCCCCCC(=O)NCc1cccc(-c2ccc([C@H]3OC(c4ccc(CO)cc4)[C@@H](C)[C@@H](CSc4ccc(C(=O)O)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C41H46N2O7S/c1-27-37(26-51-36-20-18-33(19-21-36)40(47)48)49-41(50-39(27)32-12-10-29(25-44)11-13-32)34-16-14-31(15-17-34)35-8-6-7-30(23-35)24-43-38(46)9-4-3-5-22-42-28(2)45/h6-8,10-21,23,27,37,39,41,44H,3-5,9,22,24-26H2,1-2H3,(H,42,45)(H,43,46)(H,47,48)/t27-,37+,39?,41+/m0/s1 |
| InChIKey | GQAIPORDUDMTER-SFRXZTOVSA-N |
| XLogP | 7.44 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.89 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|