C34H40N2O7S — CID 6684755
4-[[(2S,4S,5R,6R)-2-[3-(6-acetamidohexanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6684755) has the molecular formula C34H40N2O7S and a molecular weight of 620.77 g/mol. Its IUPAC name is 4-[[(2S,4S,5R,6R)-2-[3-(6-acetamidohexanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2S,4S,5R,6R)-2-[3-(6-acetamidohexanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6684755 |
| Molecular Formula | C34H40N2O7S |
| Molecular Weight | 620.77 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 4-[[(2S,4S,5R,6R)-2-[3-(6-acetamidohexanoylamino)phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | CC(=O)NCCCCCC(=O)Nc1cccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3ccc(C(=O)O)cc3)O2)c1 |
| InChI | InChI=1S/C34H40N2O7S/c1-22-30(21-44-29-16-14-26(15-17-29)33(40)41)42-34(43-32(22)25-12-10-24(20-37)11-13-25)27-7-6-8-28(19-27)36-31(39)9-4-3-5-18-35-23(2)38/h6-8,10-17,19,22,30,32,34,37H,3-5,9,18,20-21H2,1-2H3,(H,35,38)(H,36,39)(H,40,41)/t22-,30+,32?,34+/m0/s1 |
| InChIKey | QTLHVTLVKWQWDX-HUBPVFDGSA-N |
| XLogP | 6.10 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.77 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|