C34H40N6O6S — CID 6692109
6-acetamido-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]hexanamide (PubChem CID 6692109) has the molecular formula C34H40N6O6S and a molecular weight of 660.80 g/mol. Its IUPAC name is 6-acetamido-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]hexanamide.
| Compound Name | 6-acetamido-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 6692109 |
| Molecular Formula | C34H40N6O6S |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | 6-acetamido-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1cccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CSc3nnnn3-c3ccc(O)cc3)O2)c1 |
| InChI | InChI=1S/C34H40N6O6S/c1-22-30(21-47-34-37-38-39-40(34)28-14-16-29(43)17-15-28)45-33(46-32(22)25-12-10-24(20-41)11-13-25)26-7-6-8-27(19-26)36-31(44)9-4-3-5-18-35-23(2)42/h6-8,10-17,19,22,30,32-33,41,43H,3-5,9,18,20-21H2,1-2H3,(H,35,42)(H,36,44)/t22-,30+,32?,33+/m1/s1 |
| InChIKey | IWIRQJPNPSYEGL-OIBOSZQISA-N |
| XLogP | 5.08 |
| TPSA | 160.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|