C40H46N2O5S — CID 6688155
6-acetamido-N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 6688155) has the molecular formula C40H46N2O5S and a molecular weight of 666.88 g/mol. Its IUPAC name is 6-acetamido-N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6688155 |
| Molecular Formula | C40H46N2O5S |
| Molecular Weight | 666.88 g/mol |
| Exact Mass | 666.31 |
| IUPAC Name | 6-acetamido-N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1ccccc1-c1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CSc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C40H46N2O5S/c1-28-37(27-48-35-12-5-3-6-13-35)46-40(47-39(28)32-18-16-30(26-43)17-19-32)33-22-20-31(21-23-33)36-14-9-8-11-34(36)25-42-38(45)15-7-4-10-24-41-29(2)44/h3,5-6,8-9,11-14,16-23,28,37,39-40,43H,4,7,10,15,24-27H2,1-2H3,(H,41,44)(H,42,45)/t28-,37+,39?,40+/m1/s1 |
| InChIKey | MKYVMDQHHBNIEB-QFHBRURSSA-N |
| XLogP | 7.74 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.88 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|